5-bromo-2-chloro-N-(5-(isopropylthio)-1,3,4-thiadiazol-2-yl)benzamide structure
|
Common Name | 5-bromo-2-chloro-N-(5-(isopropylthio)-1,3,4-thiadiazol-2-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 391875-65-3 | Molecular Weight | 392.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11BrClN3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-2-chloro-N-(5-(isopropylthio)-1,3,4-thiadiazol-2-yl)benzamide |
|---|
| Molecular Formula | C12H11BrClN3OS2 |
|---|---|
| Molecular Weight | 392.7 |
| InChIKey | FXBCFLXIHGUTMD-UHFFFAOYSA-N |
| SMILES | CC(C)SC1=NN=C(S1)NC(=O)C2=C(C=CC(=C2)Br)Cl |
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|