1,2,5-trifluoro-3-(trifluoromethyl)benzene
Modify Date: 2025-11-27 12:10:25
1,2,5-trifluoro-3-(trifluoromethyl)benzene structure
|
Common Name | 1,2,5-trifluoro-3-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 392-91-6 | Molecular Weight | 200.08100 | |
| Density | 1.475g/cm3 | Boiling Point | 107ºC at 760 mmHg | |
| Molecular Formula | C7H2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 21.1ºC | |
| Name | 1,2,5-trifluoro-3-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 107ºC at 760 mmHg |
| Molecular Formula | C7H2F6 |
| Molecular Weight | 200.08100 |
| Flash Point | 21.1ºC |
| Exact Mass | 200.00600 |
| LogP | 3.12270 |
| Index of Refraction | 1.377 |
| InChIKey | YFAHGRXUHXCMCT-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)c(F)c(C(F)(F)F)c1 |
| HS Code | 2903999090 |
|---|
|
~36%
1,2,5-trifluoro... CAS#:392-91-6 |
| Literature: Senaweera, Sameera M.; Singh, Anuradha; Weaver, Jimmie D. Journal of the American Chemical Society, 2014 , vol. 136, # 8 p. 3002 - 3005 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:654-87-5| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3,5-Trifluorbenzotrifluorid |
| 1,2,5-trifluoro-3-trifluoromethyl-benzene |
| 2,3,4,6-TETRA-O-BENZOYL-D-GALACTOPYRANOSE |
| 2,3,5-Trifluorobenzotrifluoride |
| 1,2,5-Trifluor-3-trifluormethyl-benzol |