benazolin-methyl ester
benazolin-methyl ester structure
|
Common Name | benazolin-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 39205-60-2 | Molecular Weight | 257.69300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benazolin-methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8ClNO3S |
|---|---|
| Molecular Weight | 257.69300 |
| Exact Mass | 256.99100 |
| PSA | 76.54000 |
| LogP | 1.88940 |
| InChIKey | ZCDHYAMAXOZQDI-UHFFFAOYSA-N |
| SMILES | COC(=O)Cn1c(=O)sc2cccc(Cl)c21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 4-chloro-2-oxo-2H-chromene-3-carboxylate |
| 4-chloro-2-oxo-2H-chromene-3-carboxylic acid ethyl ester |
| 4-Chlor-2-oxo-2H-chromen-3-carbonsaeure-aethylester |
| 3-Methoxycarbonylmethyl-4-chlor-benzothiazolin-2-on |
| 4-Chlor-2-oxobenzthiazolinyl-3-essigsaeuremethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of benazolin-methyl ester? |
| A: SMILES notation of benazolin-methyl ester is COC(=O)Cn1c(=O)sc2cccc(Cl)c21. |
| Q: What is the polar surface area (PSA) of benazolin-methyl ester? |
| A: Polar surface area (PSA) of benazolin-methyl ester is 76.54000. |
| Q: What is the English name of benazolin-methyl ester? |
| A: The English name of benazolin-methyl ester is benazolin-methyl ester. |
| Q: What is the InChIKey of benazolin-methyl ester? |
| A: InChIKey of benazolin-methyl ester is ZCDHYAMAXOZQDI-UHFFFAOYSA-N. |
| Q: What is the CAS number of benazolin-methyl ester? |
| A: CAS number of benazolin-methyl ester is 39205-60-2. |
| Q: What is the molecular formula of benazolin-methyl ester? |
| A: Molecular formula of benazolin-methyl ester is C10H8ClNO3S. |
| Q: What English synonyms does benazolin-methyl ester have? |
| A: English synonyms of benazolin-methyl ester: ethyl 4-chloro-2-oxo-2H-chromene-3-carboxylate, 4-chloro-2-oxo-2H-chromene-3-carboxylic acid ethyl ester, 4-Chlor-2-oxo-2H-chromen-3-carbonsaeure-aethylester, 3-Methoxycarbonylmethyl-4-chlor-benzothiazolin-2-on, 4-Chlor-2-oxobenzthiazolinyl-3-essigsaeuremethylester. |
| Q: What is the molecular weight of benazolin-methyl ester? |
| A: Molecular weight of benazolin-methyl ester is 257.69300. |
| Q: What is the LogP of benazolin-methyl ester? |
| A: LogP of benazolin-methyl ester is 1.88940. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |