4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline
Modify Date: 2026-07-01 12:46:05
4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline structure
|
Common Name | 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 39211-42-2 | Molecular Weight | 239.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClF3NO |
|---|---|
| Molecular Weight | 239.62 |
| InChIKey | WHAYOEQWFQMIIQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(OC(F)(F)C(F)Cl)ccc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 39211-42-2? |
| A: Chinese name of 39211-42-2 is 39211-42-2. |
| Q: What is the SMILES notation of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline? |
| A: SMILES notation of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline is Cc1cc(OC(F)(F)C(F)Cl)ccc1N. |
| Q: What is the molecular weight of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline? |
| A: Molecular weight of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline is 239.62. |
| Q: What is the English name of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline? |
| A: The English name of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline is 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline. |
| Q: What is the molecular formula of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline? |
| A: Molecular formula of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline is C9H9ClF3NO. |
| Q: What is the CAS number of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline? |
| A: CAS number of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline is 39211-42-2. |
| Q: What is the InChIKey of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline? |
| A: InChIKey of 4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methyl-aniline is WHAYOEQWFQMIIQ-UHFFFAOYSA-N. |