1-bromo-4-(2,2,2-trichloro-1-phenyl-ethyl)benzene structure
|
Common Name | 1-bromo-4-(2,2,2-trichloro-1-phenyl-ethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 39211-93-3 | Molecular Weight | 364.49200 | |
| Density | 1.541g/cm3 | Boiling Point | 410.8ºC at 760 mmHg | |
| Molecular Formula | C14H10BrCl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.3ºC | |
| Name | 1-bromo-4-(2,2,2-trichloro-1-phenylethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.541g/cm3 |
|---|---|
| Boiling Point | 410.8ºC at 760 mmHg |
| Molecular Formula | C14H10BrCl3 |
| Molecular Weight | 364.49200 |
| Flash Point | 234.3ºC |
| Exact Mass | 361.90300 |
| LogP | 5.95120 |
| Index of Refraction | 1.613 |
| InChIKey | NBTGDHBAHMODDU-UHFFFAOYSA-N |
| SMILES | ClC(Cl)(Cl)C(c1ccccc1)c1ccc(Br)cc1 |
|
~%
1-bromo-4-(2,2,... CAS#:39211-93-3 |
| Literature: Chattaway; Muir Journal of the Chemical Society, 1934 , p. 701 |
|
~%
1-bromo-4-(2,2,... CAS#:39211-93-3 |
| Literature: Chattaway; Muir Journal of the Chemical Society, 1934 , p. 701 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 1-Phenyl-1-<p-brom-phenyl>-2,2,2-trichloraethan |
| NBTGDHBAHMODDU-UHFFFAOYSA |