Diphenhydramine N-Oxide structure
|
Common Name | Diphenhydramine N-Oxide | ||
|---|---|---|---|---|
| CAS Number | 3922-74-5 | Molecular Weight | 271.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Diphenhydramine N-OxideAmoxydramine is a metabolite of Diphenhydramine in humans. |
| Name | 2-benzhydryloxy-N,N-dimethylethanamine oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21NO2 |
|---|---|
| Molecular Weight | 271.35400 |
| Exact Mass | 271.15700 |
| PSA | 38.66000 |
| LogP | 3.38770 |
| InChIKey | OEQNVWKWQPTBSC-UHFFFAOYSA-N |
| SMILES | C[N+](C)([O-])CCOC(c1ccccc1)c1ccccc1 |
| HS Code | 2922509090 |
|---|
|
~%
Diphenhydramine... CAS#:3922-74-5 |
| Literature: Funcke; Nauta Arzneimittel-Forschung, 1971 , vol. 21, # 12 p. 2107 - 2109 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UNII-BXF64Y8AFS |
| Diphenylhydraminaminooxid |
| Diphenylhydrazin-N-oxid |
| Diphenhydramin-N-oxid |
| 2-benzhydryloxyethyl-dimethyl-oxido-azanium |
| Diphenhydramine N-Oxide |