2-(1-methylimidazol-2-yl)sulfanyl-5-nitro-1,3-thiazole structure
|
Common Name | 2-(1-methylimidazol-2-yl)sulfanyl-5-nitro-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 39259-57-9 | Molecular Weight | 242.27800 | |
| Density | 1.7g/cm3 | Boiling Point | 483.6ºC at 760mmHg | |
| Molecular Formula | C7H6N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.2ºC | |
| Name | 2-(1-methylimidazol-2-yl)sulfanyl-5-nitro-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760mmHg |
| Molecular Formula | C7H6N4O2S2 |
| Molecular Weight | 242.27800 |
| Flash Point | 246.2ºC |
| Exact Mass | 241.99300 |
| PSA | 130.07000 |
| LogP | 2.45920 |
| Index of Refraction | 1.802 |
| InChIKey | SVIJDDPKNUIEGC-UHFFFAOYSA-N |
| SMILES | Cn1ccnc1Sc1ncc([N+](=O)[O-])s1 |
| HS Code | 2934999090 |
|---|
|
~82%
2-(1-methylimid... CAS#:39259-57-9 |
| Literature: Bourdais; Dauvillier; Gayral; et al. European Journal of Medicinal Chemistry, 1981 , vol. 16, # 3 p. 233 - 239 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| SU 3003 |
| 2-(1-methyl-1H-imidazol-2-ylsulfanyl)-5-nitro-thiazole |
| Thiazole,2-[(1-methyl-1H-imidazol-2-yl)thio]-5-nitro |