1-(7,7-dioxido-14h-dibenzo[a,h]phenothiazin-14-yl)ethanone structure
|
Common Name | 1-(7,7-dioxido-14h-dibenzo[a,h]phenothiazin-14-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 3929-79-1 | Molecular Weight | 373.42400 | |
| Density | 1.418g/cm3 | Boiling Point | 718.7ºC at 760 mmHg | |
| Molecular Formula | C22H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.5ºC | |
| Name | 1-(7,7-dioxido-14h-dibenzo[a,h]phenothiazin-14-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 718.7ºC at 760 mmHg |
| Molecular Formula | C22H15NO3S |
| Molecular Weight | 373.42400 |
| Flash Point | 388.5ºC |
| Exact Mass | 373.07700 |
| PSA | 62.83000 |
| LogP | 5.96960 |
| Index of Refraction | 1.744 |
| InChIKey | HMZGPLZRACMDAI-UHFFFAOYSA-N |
| SMILES | CC(=O)N1c2ccc3ccccc3c2S(=O)(=O)c2ccc3ccccc3c21 |
|
~%
1-(7,7-dioxido-... CAS#:3929-79-1 |
| Literature: Shirley,D.A. et al. Journal of the Chemical Society, 1964 , p. 5260 - 5264 |
|
~%
1-(7,7-dioxido-... CAS#:3929-79-1 |
| Literature: Shirley,D.A. et al. Journal of the Chemical Society, 1964 , p. 5260 - 5264 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 14-Acetyl-14H-dibenzo<a,h>phenthiazin-7.7-dioxyd |
| 14-acetyl-14H-dibenzo[a,h]phenothiazine 7,7-dioxide |