2-(4-tert-butylphenyl)sulfonylacetic acid structure
|
Common Name | 2-(4-tert-butylphenyl)sulfonylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 3937-98-2 | Molecular Weight | 256.31800 | |
| Density | 1.226g/cm3 | Boiling Point | 445.7ºC at 760 mmHg | |
| Molecular Formula | C12H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
| Name | 4-tert.-Butylphenylsulfonyl-essigsaeure |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760 mmHg |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.31800 |
| Flash Point | 223.3ºC |
| Exact Mass | 256.07700 |
| PSA | 79.82000 |
| LogP | 2.92320 |
| Index of Refraction | 1.534 |
| InChIKey | ACTDBYUMAHCONF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CC(=O)O)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
2-(4-tert-butyl... CAS#:3937-98-2 |
| Literature: Kenney,W. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 4019 - 4022 |
|
~%
2-(4-tert-butyl... CAS#:3937-98-2 |
| Literature: Pasto,D.J. et al. Journal of Organic Chemistry, 1965 , vol. 30, p. 2688 - 2691 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-TERT-BUTYL-1H-IMIDAZOLE-2-THIOL |
| 4-t-Butyl-imidazol-2-thiol |
| 4-tert.butylimidazole-2-thiol |