1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one
Modify Date: 2025-11-30 07:29:00
1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one structure
|
Common Name | 1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 394-26-3 | Molecular Weight | 286.29800 | |
| Density | 1.182g/cm3 | Boiling Point | 448.4ºC at 760 mmHg | |
| Molecular Formula | C17H15FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217ºC | |
| Name | 1-(2,4-dimethoxyphenyl)-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 448.4ºC at 760 mmHg |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.29800 |
| Flash Point | 217ºC |
| Exact Mass | 286.10100 |
| PSA | 35.53000 |
| LogP | 3.73900 |
| Index of Refraction | 1.579 |
| InChIKey | FRCWAQMDSSPPFN-BJMVGYQFSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc(F)cc2)c(OC)c1 |
| HS Code | 2914700090 |
|---|
|
~17%
1-(2,4-dimethox... CAS#:394-26-3 |
| Literature: Liu; Wilairat; Go Journal of Medicinal Chemistry, 2001 , vol. 44, # 25 p. 4443 - 4452 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-fluoro-2',4'-dimethoxy-trans-chalcone |
| 4-Fluor-2',4'-dimethoxy-trans-chalkon |