[1,1'-Biphenyl]-2,3'-diol,4,4'-difluoro- structure
|
Common Name | [1,1'-Biphenyl]-2,3'-diol,4,4'-difluoro- | ||
|---|---|---|---|---|
| CAS Number | 394-78-5 | Molecular Weight | 222.18800 | |
| Density | 1.388g/cm3 | Boiling Point | 350.9ºC at 760 mmHg | |
| Molecular Formula | C12H8F2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | 2-fluoro-5-(4-fluoro-2-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 350.9ºC at 760 mmHg |
| Molecular Formula | C12H8F2O2 |
| Molecular Weight | 222.18800 |
| Flash Point | 166ºC |
| Exact Mass | 222.04900 |
| PSA | 40.46000 |
| LogP | 3.04300 |
| Index of Refraction | 1.598 |
| InChIKey | WPCWNCJRRAUCHO-UHFFFAOYSA-N |
| SMILES | Oc1cc(-c2ccc(F)cc2O)ccc1F |
|
~%
[1,1'-Biphenyl]... CAS#:394-78-5 |
| Literature: Roe; Fleishman Journal of the American Chemical Society, 1947 , vol. 69, p. 509 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,4'-difluoro-biphenyl-2,3'-diol |
| 4,4'-Difluor-biphenyl-2,3'-diol |
| 4.4'-Difluor-2.3'-dihydroxy-biphenyl |