Benzamide,3,4,5-trimethoxy-N-phenyl structure
|
Common Name | Benzamide,3,4,5-trimethoxy-N-phenyl | ||
|---|---|---|---|---|
| CAS Number | 3940-75-8 | Molecular Weight | 287.31000 | |
| Density | 1.195g/cm3 | Boiling Point | 378ºC at 760mmHg | |
| Molecular Formula | C16H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | 3,4,5-trimethoxy-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 378ºC at 760mmHg |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31000 |
| Flash Point | 182.4ºC |
| Exact Mass | 287.11600 |
| PSA | 56.79000 |
| LogP | 3.03770 |
| Index of Refraction | 1.587 |
| InChIKey | PCAHHUDNCNWNIG-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Nc2ccccc2)cc(OC)c1OC |
| HS Code | 2924299090 |
|---|
|
~95%
Benzamide,3,4,5... CAS#:3940-75-8 |
| Literature: Cabre-Castellvi, Juan; Palomo-Coll, Antonio Luis Tetrahedron Letters, 1980 , vol. 21, p. 4179 - 4182 |
|
~%
Benzamide,3,4,5... CAS#:3940-75-8 |
| Literature: Sonn; Mueller Chemische Berichte, 1919 , vol. 52, p. 1930 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Calcein-AM Assay from Article 10.1111/cbdd.12811: "Design, synthesis, biological eval...
Source: BindingDB
Target: N/A
External Id: BindingDB_7565_1
|
| 3,4,5-Trimethoxy-benzoesaeure-anilid |
| Trimethylaethergallussaeure-anilid |
| 3,4,5-TRIMETHOXYBENZANILIDE |
| 3.4.5-Trimethoxybenzanilid |
| 3,4,5-trimethoxy-benzoic acid anilide |