2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide
Modify Date: 2026-06-26 19:35:19
2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide structure
|
Common Name | 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 394232-53-2 | Molecular Weight | 378.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N4OS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N4OS3 |
|---|---|
| Molecular Weight | 378.5 |
| InChIKey | LUSABJLFSYQKGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NN=C(S2)NC(=O)CSC3=NCCS3)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide? |
| A: InChIKey of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide is LUSABJLFSYQKGB-UHFFFAOYSA-N. |
| Q: What is the English name of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide? |
| A: The English name of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide is 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide. |
| Q: What is the Chinese name of 394232-53-2? |
| A: Chinese name of 394232-53-2 is 394232-53-2. |
| Q: What is the SMILES notation of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide? |
| A: SMILES notation of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide is CC1=CC(=C(C(=C1)C)C2=NN=C(S2)NC(=O)CSC3=NCCS3)C. |
| Q: What is the molecular weight of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide? |
| A: Molecular weight of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide is 378.5. |
| Q: What is the molecular formula of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide? |
| A: Molecular formula of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide is C16H18N4OS3. |
| Q: What is the CAS number of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide? |
| A: CAS number of 2-((4,5-dihydrothiazol-2-yl)thio)-N-(5-mesityl-1,3,4-thiadiazol-2-yl)acetamide is 394232-53-2. |