3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate
Modify Date: 2026-09-27 15:47:09
3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate structure
|
Common Name | 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 394251-18-4 | Molecular Weight | 265.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8ClNO5S |
|---|---|
| Molecular Weight | 265.67 |
| InChIKey | DIJCZLHHDWCKNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)O)cnc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate? |
| A: InChIKey of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate is DIJCZLHHDWCKNS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate? |
| A: Molecular weight of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate is 265.67. |
| Q: What is the SMILES notation of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate? |
| A: SMILES notation of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate is CCOC(=O)c1cc(S(=O)(=O)O)cnc1Cl. |
| Q: What is the English name of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate? |
| A: The English name of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate is 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate. |
| Q: What is the Chinese name of 394251-18-4? |
| A: Chinese name of 394251-18-4 is 394251-18-4. |
| Q: What is the CAS number of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate? |
| A: CAS number of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate is 394251-18-4. |
| Q: What is the molecular formula of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate? |
| A: Molecular formula of 3-Ethyl 2-chloro-5-sulfo-3-pyridinecarboxylate is C8H8ClNO5S. |