1,1-diphenylsiletane
1,1-diphenylsiletane structure
|
Common Name | 1,1-diphenylsiletane | ||
|---|---|---|---|---|
| CAS Number | 3944-09-0 | Molecular Weight | 224.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-diphenylsiletane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16Si |
|---|---|
| Molecular Weight | 224.37300 |
| Exact Mass | 224.10200 |
| LogP | 2.65330 |
| InChIKey | ATHVAXPIJDDUHO-UHFFFAOYSA-N |
| SMILES | c1ccc([Si]2(c3ccccc3)CCC2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2902909090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:2319-40-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-Diphenyl-1-silacyclobutane |
| 1,3-diphenylsiletane |
| 1,1-diphenyl-siletane |
| 1,1-diphenyl-1-silacylobutane |
| Silacyclobutane,1,1-diphenyl |
| 1,1-diphenylsilacyclobutane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,1-diphenylsiletane? |
| A: Molecular weight of 1,1-diphenylsiletane is 224.37300. |
| Q: What is the molecular formula of 1,1-diphenylsiletane? |
| A: Molecular formula of 1,1-diphenylsiletane is C15H16Si. |
| Q: What is the SMILES notation of 1,1-diphenylsiletane? |
| A: SMILES notation of 1,1-diphenylsiletane is c1ccc([Si]2(c3ccccc3)CCC2)cc1. |
| Q: What English synonyms does 1,1-diphenylsiletane have? |
| A: English synonyms of 1,1-diphenylsiletane: 1,1-Diphenyl-1-silacyclobutane, 1,3-diphenylsiletane, 1,1-diphenyl-siletane, 1,1-diphenyl-1-silacylobutane, Silacyclobutane,1,1-diphenyl, 1,1-diphenylsilacyclobutane. |
| Q: What is the English name of 1,1-diphenylsiletane? |
| A: The English name of 1,1-diphenylsiletane is 1,1-diphenylsiletane. |
| Q: What is the LogP of 1,1-diphenylsiletane? |
| A: LogP of 1,1-diphenylsiletane is 2.65330. |
| Q: What is the InChIKey of 1,1-diphenylsiletane? |
| A: InChIKey of 1,1-diphenylsiletane is ATHVAXPIJDDUHO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 3944-09-0? |
| A: Chinese name of 3944-09-0 is 3944-09-0. |
| Q: What is the CAS number of 1,1-diphenylsiletane? |
| A: CAS number of 1,1-diphenylsiletane is 3944-09-0. |
| Q: What are the downstream products of 1,1-diphenylsiletane? |
| A: Related downstream products(CAS) of 1,1-diphenylsiletane: 2319-40-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |