ac1lbd6o
Modify Date: 2025-10-13 13:09:35
ac1lbd6o structure
|
Common Name | ac1lbd6o | ||
|---|---|---|---|---|
| CAS Number | 39478-67-6 | Molecular Weight | 560.39400 | |
| Density | 1.46g/cm3 | Boiling Point | 644ºC at 760 mmHg | |
| Molecular Formula | C28H22Cl2F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 343.3ºC | |
| Name | ac1lbd6o |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 644ºC at 760 mmHg |
| Molecular Formula | C28H22Cl2F3N3O2 |
| Molecular Weight | 560.39400 |
| Flash Point | 343.3ºC |
| Exact Mass | 559.10400 |
| PSA | 37.83000 |
| LogP | 7.14040 |
| Index of Refraction | 1.647 |
| InChIKey | GBPSHGIXMXUSIG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc2c3c(c4c(c2n1)OCN(Cc1ccc(Cl)cc1)C4)CN(Cc1ccc(Cl)cc1)CO3 |
|
~%
ac1lbd6o CAS#:39478-67-6 |
| Literature: Bajwa,G.S. et al. Journal of Medicinal Chemistry, 1973 , vol. 16, p. 134 - 138 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |