1,2-Naphthalenediol,6-(dimethylamino)-5,6,7,8-tetrahydro-(9CI)
Modify Date: 2026-07-15 19:13:03
1,2-Naphthalenediol,6-(dimethylamino)-5,6,7,8-tetrahydro-(9CI) structure
|
Common Name | 1,2-Naphthalenediol,6-(dimethylamino)-5,6,7,8-tetrahydro-(9CI) | ||
|---|---|---|---|---|
| CAS Number | 39478-90-5 | Molecular Weight | 207.26900 | |
| Density | N/A | Boiling Point | 363.7ºC at 760mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.1ºC | |
| Name | 6-(dimethylamino)-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 363.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Flash Point | 192.1ºC |
| Exact Mass | 207.12600 |
| PSA | 43.70000 |
| LogP | 1.51670 |
| InChIKey | LSHRDKPBUUXBAF-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCc2c(ccc(O)c2O)C1 |
| HS Code | 2922299090 |
|---|
|
~%
1,2-Naphthalene... CAS#:39478-90-5 |
| Literature: McDermed; McKenzie; Phillips Journal of Medicinal Chemistry, 1975 , vol. 18, # 4 p. 362 - 367 |
|
~%
1,2-Naphthalene... CAS#:39478-90-5 |
| Literature: McDermed; McKenzie; Phillips Journal of Medicinal Chemistry, 1975 , vol. 18, # 4 p. 362 - 367 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5,6-Dihydroxy-2-dimethylaminotetralin |
| N,N-Dimethyl-5,6-dihydroxy-2-aminotetralin |
| 2-Dimethylamino-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalene |
| m 7 (pharmaceutical) |
| 2-N,N-Dimethylamino-5,6-dihydroxytetralin |
| 2-(N,N-Dimethylamino)-5,6-dihydroxy-1,2,3,4-tetrahydronaphthalene |
| 6-(Dimethylamino)-5,6,7,8-tetrahydro-1,2-naphthalenediol |