1,4-bis(methylsulfonylsulfanylmethyl)benzene
1,4-bis(methylsulfonylsulfanylmethyl)benzene structure
|
Common Name | 1,4-bis(methylsulfonylsulfanylmethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 3948-46-7 | Molecular Weight | 326.47600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,4-bis(methylsulfonylsulfanylmethyl)benzene (CAS号：3948-46-7)，molecular formula C10H14O4S4，molecular weight 326.47600，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-bis(methylsulfonylsulfanylmethyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14O4S4 |
|---|---|
| Molecular Weight | 326.47600 |
| Exact Mass | 325.97700 |
| PSA | 135.64000 |
| LogP | 4.23380 |
| InChIKey | FJJMUASPEZRNQI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCc1ccc(CSS(C)(=O)=O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2930909090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:623-24-5
CAS#:1950-85-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Alpha,Alpha`-Paraxylyl Bismethanethiosulfonate |
| p-Xylene-|A,|A'-dithiol Dimethanesulfonate |
| |A,|A'-Paraxylyl Bismethanethiosulfonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: The English name of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is 1,4-bis(methylsulfonylsulfanylmethyl)benzene. |
| Q: What are the upstream materials of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: Related upstream materials(CAS) of 1,4-bis(methylsulfonylsulfanylmethyl)benzene: 623-24-5;1950-85-2. |
| Q: What English synonyms does 1,4-bis(methylsulfonylsulfanylmethyl)benzene have? |
| A: English synonyms of 1,4-bis(methylsulfonylsulfanylmethyl)benzene: Alpha,Alpha`-Paraxylyl Bismethanethiosulfonate, p-Xylene-|A,|A'-dithiol Dimethanesulfonate, |A,|A'-Paraxylyl Bismethanethiosulfonate. |
| Q: What is the CAS number of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: CAS number of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is 3948-46-7. |
| Q: What is the molecular weight of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: Molecular weight of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is 326.47600. |
| Q: What is the LogP of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: LogP of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is 4.23380. |
| Q: What is the InChIKey of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: InChIKey of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is FJJMUASPEZRNQI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: Molecular formula of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is C10H14O4S4. |
| Q: What is the SMILES notation of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: SMILES notation of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is CS(=O)(=O)SCc1ccc(CSS(C)(=O)=O)cc1. |
| Q: What is the polar surface area (PSA) of 1,4-bis(methylsulfonylsulfanylmethyl)benzene? |
| A: Polar surface area (PSA) of 1,4-bis(methylsulfonylsulfanylmethyl)benzene is 135.64000. |