1-(4-methoxyphenoxy)-3,3-dimethyl-butan-2-one structure
|
Common Name | 1-(4-methoxyphenoxy)-3,3-dimethyl-butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 39489-43-5 | Molecular Weight | 222.28000 | |
| Density | 1.023g/cm3 | Boiling Point | 317.6ºC at 760 mmHg | |
| Molecular Formula | C13H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.9ºC | |
| Name | 1-(4-methoxyphenoxy)-3,3-dimethylbutan-2-one |
|---|
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 317.6ºC at 760 mmHg |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28000 |
| Flash Point | 136.9ºC |
| Exact Mass | 222.12600 |
| PSA | 35.53000 |
| LogP | 2.68920 |
| Index of Refraction | 1.489 |
| InChIKey | GUKJNWZZYFEWDH-UHFFFAOYSA-N |
| SMILES | COc1ccc(OCC(=O)C(C)(C)C)cc1 |
|
~%
1-(4-methoxyphe... CAS#:39489-43-5 |
| Literature: White,W.N.; Norcross,B.E. Journal of the American Chemical Society, 1961 , vol. 83, p. 3265 - 3269 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |