N-bis(dibutylamino)phosphinothioyl-N-butylbutan-1-amine
Modify Date: 2025-08-26 12:23:35
N-bis(dibutylamino)phosphinothioyl-N-butylbutan-1-amine structure
|
Common Name | N-bis(dibutylamino)phosphinothioyl-N-butylbutan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 3949-47-1 | Molecular Weight | 447.74400 | |
| Density | 0.935g/cm3 | Boiling Point | 500ºC at 760 mmHg | |
| Molecular Formula | C24H54N3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.2ºC | |
| Name | N-bis(dibutylamino)phosphinothioyl-N-butylbutan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.935g/cm3 |
|---|---|
| Boiling Point | 500ºC at 760 mmHg |
| Molecular Formula | C24H54N3PS |
| Molecular Weight | 447.74400 |
| Flash Point | 256.2ºC |
| Exact Mass | 447.37800 |
| PSA | 51.62000 |
| LogP | 8.56810 |
| Index of Refraction | 1.49 |
| InChIKey | MAEYAXJKWCYNNG-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)P(=S)(N(CCCC)CCCC)N(CCCC)CCCC |
|
~%
N-bis(dibutylam... CAS#:3949-47-1 |
| Literature: Stuebe; Lankelma Journal of the American Chemical Society, 1956 , vol. 78, p. 976 |
|
~%
N-bis(dibutylam... CAS#:3949-47-1 |
| Literature: Stuebe; Lankelma Journal of the American Chemical Society, 1956 , vol. 78, p. 976 |
| phosphinotris(dibutylamino)-1-thione |
| Phosphorothioictriamide,hexabutyl-(7CI,8CI,9CI) |
| Hexabutylthiophosphoramide |
| Thiophosphorsaeure-tris-dibutylamid |
| hexabutyl-thiophosphamide |