4-ethoxy-N-(4-ethoxyphenyl)aniline structure
|
Common Name | 4-ethoxy-N-(4-ethoxyphenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 3949-80-2 | Molecular Weight | 257.32800 | |
| Density | 1.088g/cm3 | Boiling Point | 396.9ºC at 760 mmHg | |
| Molecular Formula | C16H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.1ºC | |
| Name | 4-ethoxy-N-(4-ethoxyphenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 396.9ºC at 760 mmHg |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.32800 |
| Flash Point | 165.1ºC |
| Exact Mass | 257.14200 |
| PSA | 30.49000 |
| LogP | 4.30060 |
| Index of Refraction | 1.575 |
| InChIKey | DIIPPPQHZIQJOP-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(Nc2ccc(OCC)cc2)cc1 |
|
~%
4-ethoxy-N-(4-e... CAS#:3949-80-2 |
| Literature: Palat et al. Collection of Czechoslovak Chemical Communications, 1957 , vol. 22, p. 825,828 |
|
~%
4-ethoxy-N-(4-e... CAS#:3949-80-2 |
| Literature: Crowther; Mann; Purdie Journal of the Chemical Society, 1943 , p. 58,65 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis-<4-aethoxy-phenyl>-amin |
| 4,4'-Diaethoxy-diphenyl-amin |
| p,p-Diaethoxy-diphenylamin |
| bis-(4-ethoxy-phenyl)-amine |