1H-Pyrimido[5,4-b][1,4]thiazine-2,4,7(3H,6H,8H)-trione, 3-ethyl-1-propyl- structure
|
Common Name | 1H-Pyrimido[5,4-b][1,4]thiazine-2,4,7(3H,6H,8H)-trione, 3-ethyl-1-propyl- | ||
|---|---|---|---|---|
| CAS Number | 3950-00-3 | Molecular Weight | 269.32000 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-1-propyl-8H-pyrimido[5,4-b][1,4]thiazine-2,4,7-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.32000 |
| Exact Mass | 269.08300 |
| PSA | 98.40000 |
| LogP | 0.62210 |
| Index of Refraction | 1.628 |
| InChIKey | KFMXTNPXSBTKQV-UHFFFAOYSA-N |
| SMILES | CCCn1c2c(c(=O)n(CC)c1=O)SCC(=O)N2 |
|
~%
1H-Pyrimido[5,4... CAS#:3950-00-3 |
| Literature: Schroeder,E.F.; Dodson,R.M. Journal of the American Chemical Society, 1962 , vol. 84, p. 1904 - 1913 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 5-Propyl-7-aethyl-3,6,8-trioxo-pyrimido<5,4-b>-1,4-thiazin |
| 3-ethyl-1-propyl-1h-pyrimido[5,4-b][1,4]thiazine-2,4,7(3h,6h,8h)-trione |
| 7-Ethyl-5-propyl-3.6.8-trioxopyrimido<5.4-b>-1.4-thiazin |
| 3-ethyl-1-propyl-1H,8H-pyrimido[5,4-b][1,4]thiazine-2,4,7-trione |
| 1-Propyl-3-aethyl-1H-pyrimido <5.4-b><1.4> thiazin-2,4,7(3H,6H,8H)-trion |