Demethyl Chlorpromazine Hydrochloride
Modify Date: 2025-08-26 15:06:53
Demethyl Chlorpromazine Hydrochloride structure
|
Common Name | Demethyl Chlorpromazine Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 3953-65-9 | Molecular Weight | 341.29900 | |
| Density | N/A | Boiling Point | 458.2ºC at 760 mmHg | |
| Molecular Formula | C16H18Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.9ºC | |
| Name | Demethyl Chlorpromazine Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 458.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H18Cl2N2S |
| Molecular Weight | 341.29900 |
| Flash Point | 230.9ºC |
| Exact Mass | 340.05700 |
| PSA | 40.57000 |
| LogP | 5.81010 |
| InChIKey | HDISSMQVJRSCEK-UHFFFAOYSA-N |
| SMILES | CNCCCN1c2ccccc2Sc2ccc(Cl)cc21.Cl |
| HS Code | 2934300000 |
|---|
|
~%
Demethyl Chlorp... CAS#:3953-65-9 |
| Literature: Kitamura, Keisuke; Fujitani, Kazuyoshi; Takahashi, Keiko; Tanaka, Yoshimi; Hirako, Syou; Kotani, Chie; Hashimoto, Tomoko; Takegami, Shigehiko Journal of Labelled Compounds and Radiopharmaceuticals, 2000 , vol. 43, # 9 p. 865 - 872 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Chloro-10H-phenothiazin-10-yl)-N-methyl-1-propanamine hydroc hloride (1:1) |