1-methyl-4-(3-methylphenoxy)sulfonyl-benzene structure
|
Common Name | 1-methyl-4-(3-methylphenoxy)sulfonyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 3955-72-4 | Molecular Weight | 262.32400 | |
| Density | 1.216g/cm3 | Boiling Point | 403.8ºC at 760mmHg | |
| Molecular Formula | C14H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-methylphenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 403.8ºC at 760mmHg |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.32400 |
| Exact Mass | 262.06600 |
| PSA | 51.75000 |
| LogP | 4.15190 |
| Index of Refraction | 1.575 |
| InChIKey | VIKTUZZYGHKELS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(C)c2)cc1 |
| HS Code | 2904100000 |
|---|
|
~96%
1-methyl-4-(3-m... CAS#:3955-72-4 |
| Literature: Fazaeli, Razieh; Tangestaninejad, Shahram; Aliyan, Hamid Canadian Journal of Chemistry, 2006 , vol. 84, # 5 p. 812 - 818 |
|
~58%
1-methyl-4-(3-m... CAS#:3955-72-4 |
| Literature: Sharghi, Hashem; Shahsavari-Fard, Zahra Helvetica Chimica Acta, 2005 , vol. 88, # 1 p. 42 - 52 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| m-tolyl 4-methylbenzenesulfonate |
| p-Toluenesulfonic acid,m-tolyl ester |
| toluene-4-sulfonic acid m-tolyl ester |
| Toluol-4-sulfonsaeure-m-tolylester |
| 3-methylphenyl 4-methylbenzenesulfonate |
| m-tolyl tosylate |
| 3-methylphenyl tosylsulfonate |
| 3-methylphenyl tosylate |