7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine
Modify Date: 2026-08-30 08:48:21
![7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine Structure](https://www.chemsrc.com/extcaspic/267/39554-93-3.png)
7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine structure
|
Common Name | 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine | ||
|---|---|---|---|---|
| CAS Number | 39554-93-3 | Molecular Weight | 266.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NSe |
|---|---|
| Molecular Weight | 266.25 |
| InChIKey | QEDWXSGDJGEEDU-UHFFFAOYSA-N |
| SMILES | CCc1cc(N(C)C)cc2cc(C)[se]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine? |
| A: SMILES notation of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine is CCc1cc(N(C)C)cc2cc(C)[se]c12. |
| Q: What is the molecular weight of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine? |
| A: Molecular weight of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine is 266.25. |
| Q: What is the Chinese name of 39554-93-3? |
| A: Chinese name of 39554-93-3 is 39554-93-3. |
| Q: What is the CAS number of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine? |
| A: CAS number of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine is 39554-93-3. |
| Q: What is the molecular formula of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine? |
| A: Molecular formula of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine is C13H17NSe. |
| Q: What is the English name of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine? |
| A: The English name of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine is 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine. |
| Q: What is the InChIKey of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine? |
| A: InChIKey of 7-Ethyl-N,N,2-trimethylbenzo[b]selenophen-5-amine is QEDWXSGDJGEEDU-UHFFFAOYSA-N. |