Ethyl 2-(3-nitrobenzylidene)-3-oxobutyrate structure
|
Common Name | Ethyl 2-(3-nitrobenzylidene)-3-oxobutyrate | ||
|---|---|---|---|---|
| CAS Number | 39562-16-8 | Molecular Weight | 263.246 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 399.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3±27.1 °C | |
| Name | 2-(3-Nitrobenzyliden)acetessigsaeure-ethylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.2±32.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.246 |
| Flash Point | 171.3±27.1 °C |
| Exact Mass | 263.079376 |
| PSA | 89.19000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | YOPMSDPIOQUWFE-XYOKQWHBSA-N |
| SMILES | CCOC(=O)C(=Cc1cccc([N+](=O)[O-])c1)C(C)=O |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-(3-nitrophenylmethylene)acetoacetate |
| ethyl 2-acetyl-3-(3-nitrophenyl)acrylate |
| Butanoic acid, 2-[(3-nitrophenyl)methylene]-3-oxo-, ethyl ester |
| WNR C1UYV1&VO2 |
| ethyl 2-(3-nitrophenylmethylene)-3-oxobutanoate |
| 2873280 |
| ethyl 2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| Ethyl 2-(3-nitrobenzylidene)-3-oxobutanoate |
| ETHYL 2-ACETYL-3-(3-NITROPHENYL)PROPENOATE |
| 3-Nitrobenzylidenacetessigsaeure-ethylester |
| Ethyl 2-(3-nitrobenzylidene)acetoacetate |
| ethyl (3-nitrobenzylidene)acetoacetate |
| ETHYL 2-(M-NITROBENZYLIDENE)-ACETOACETATE |
| Ethyl 2-(3-nitrobenzylidene)-3-oxobutyrate |