(Propane-2,2-diylbis(2-hydroxybenzene-5,3,1-triyl))tetramethanol structure
|
Common Name | (Propane-2,2-diylbis(2-hydroxybenzene-5,3,1-triyl))tetramethanol | ||
|---|---|---|---|---|
| CAS Number | 3957-22-0 | Molecular Weight | 348.39000 | |
| Density | 1.367g/cm3 | Boiling Point | 564.8ºC at 760 mmHg | |
| Molecular Formula | C19H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.4ºC | |
| Name | 4-[2-[4-hydroxy-3,5-bis(hydroxymethyl)phenyl]propan-2-yl]-2,6-bis(hydroxymethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 564.8ºC at 760 mmHg |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39000 |
| Flash Point | 261.4ºC |
| Exact Mass | 348.15700 |
| PSA | 121.38000 |
| LogP | 1.39290 |
| Index of Refraction | 1.659 |
| InChIKey | ZRIRUWWYQXWRNY-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(CO)c(O)c(CO)c1)c1cc(CO)c(O)c(CO)c1 |
| HS Code | 2907299090 |
|---|
|
~%
(Propane-2,2-di... CAS#:3957-22-0 |
| Literature: DAI NIPPON PRINTING CO., LTD. Patent: US2012/115084 A1, 2012 ; |
|
~%
(Propane-2,2-di... CAS#:3957-22-0 |
| Literature: Junek,H. et al. Monatshefte fuer Chemie, 1973 , vol. 104, p. 1077 - 1089 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 2,2-(4-hydroxy-3,5-dihydroxymethyl-phenyl)-propane |
| 5,5'-(1-Methylethylidene)bis(2-hydroxy-1,3-benzenedimethanol) |
| 2,2-Propandiyl-4,4'-bis(2,6-dihydroxymethylphenol) |
| 2,2-bis(4-hydroxy-3,5-dihydroxymethylphenyl)propane |
| EINECS 223-553-1 |