Benzoic acid,2,4-dichloro-, 2-(phenylmethylene)hydrazide structure
|
Common Name | Benzoic acid,2,4-dichloro-, 2-(phenylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 39575-21-8 | Molecular Weight | 293.14800 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2-tetrafluorocyclobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.14800 |
| Exact Mass | 292.01700 |
| PSA | 41.46000 |
| LogP | 4.14820 |
| Index of Refraction | 1.606 |
| InChIKey | ABKBDBXGTIMQEI-RQZCQDPDSA-N |
| SMILES | O=C(NN=Cc1ccccc1)c1ccc(Cl)cc1Cl |
|
~88%
Benzoic acid,2,... CAS#:39575-21-8 |
| Literature: Dutta; Goswami; Kataky Journal of the Indian Chemical Society, 1990 , vol. 67, # 4 p. 332 - 334 |
|
~%
Benzoic acid,2,... CAS#:39575-21-8 |
| Literature: Dutta; Goswami; Kataky Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 3 p. 793 - 795 |
| benz<2,3>indolo<5,6-b>quinoline-6,13(5H)-dione |
| Benzaldehyd-(2,4-dichlorbenzoyl)hydrazon |