2,4(1H,3H)-Pyrimidinedione,5-bromodihydro-1-(phenylmethyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,5-bromodihydro-1-(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 3959-45-3 | Molecular Weight | 283.12100 | |
| Density | 1.579g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyl-5-bromo-1,3-diazinane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.579g/cm3 |
|---|---|
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12100 |
| Exact Mass | 282.00000 |
| PSA | 49.41000 |
| LogP | 1.76860 |
| Index of Refraction | 1.615 |
| InChIKey | RSAIQVSFFIVXNW-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)N(Cc2ccccc2)CC1Br |
| HS Code | 2933599090 |
|---|
|
~27%
2,4(1H,3H)-Pyri... CAS#:3959-45-3 |
| Literature: QUEEN'S UNIVERSITY AT KINGSTON Patent: WO2004/9559 A2, 2004 ; Location in patent: Page 34 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS3092J07 |
| 1-Benzyl-5-brom-dihydro-pyrimidin-2,4-dion |
| 1-benzyl-5-bromo-dihydro-pyrimidine-2,4-dione |