Spiro[9H-fluorene-9,5'-isothiazolidine], 2'-benzoyl-4',4'-dimethyl-3'-(1-pyrrolidinyl) structure
|
Common Name | Spiro[9H-fluorene-9,5'-isothiazolidine], 2'-benzoyl-4',4'-dimethyl-3'-(1-pyrrolidinyl) | ||
|---|---|---|---|---|
| CAS Number | 39593-87-8 | Molecular Weight | 440.60000 | |
| Density | 1.29g/cm3 | Boiling Point | 587.7ºC at 760 mmHg | |
| Molecular Formula | C28H28N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.2ºC | |
| Name | (4,4-dimethyl-3-pyrrolidin-1-ylspiro[1,2-thiazolidine-5,9'-fluorene]-2-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 587.7ºC at 760 mmHg |
| Molecular Formula | C28H28N2OS |
| Molecular Weight | 440.60000 |
| Flash Point | 309.2ºC |
| Exact Mass | 440.19200 |
| PSA | 48.85000 |
| LogP | 6.03870 |
| Index of Refraction | 1.705 |
| InChIKey | PGLYNCLKWXJSBP-UHFFFAOYSA-N |
| SMILES | CC1(C)C(N2CCCC2)N(C(=O)c2ccccc2)SC12c1ccccc1-c1ccccc12 |
|
~%
Spiro[9H-fluore... CAS#:39593-87-8 |
| Literature: Burgess,E.M.; Penton,H.R. Journal of the American Chemical Society, 1973 , vol. 95, p. 279 - 280 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2'-benzoyl-4',4'-dimethyl-3'-pyrrolidin-1-yl-spiro[fluorene-9,5'-isothiazolidine] |
| [4',4'-dimethyl-3'-(pyrrolidin-1-yl)-2'H-spiro[fluorene-9,5'-[1,2]thiazolidin]-2'-yl](phenyl)methanone |