4-(2-ETHOXYPHENYL)-4-OXOBUTYRIC ACID
4-(2-ETHOXYPHENYL)-4-OXOBUTYRIC ACID structure
|
Common Name | 4-(2-ETHOXYPHENYL)-4-OXOBUTYRIC ACID | ||
|---|---|---|---|---|
| CAS Number | 39595-35-2 | Molecular Weight | 222.23700 | |
| Density | 1.175g/cm3 | Boiling Point | 402.4ºC at 760 mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-ethoxyphenyl)-4-oxobutanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 402.4ºC at 760 mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 155.9ºC |
| Exact Mass | 222.08900 |
| PSA | 63.60000 |
| LogP | 2.13280 |
| Index of Refraction | 1.53 |
| InChIKey | CBCGHBBXNYFBMF-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1C(=O)CCC(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: SMILES notation of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is CCOc1ccccc1C(=O)CCC(=O)O. |
| Q: What is the English name of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: The English name of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is 4-(2-ethoxyphenyl)-4-oxobutanoic acid. |
| Q: What is the Chinese name of 39595-35-2? |
| A: Chinese name of 39595-35-2 is 39595-35-2. |
| Q: What is the molecular weight of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: Molecular weight of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is 222.23700. |
| Q: What is the polar surface area (PSA) of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: Polar surface area (PSA) of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is 63.60000. |
| Q: What is the boiling point of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: Boiling point of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is 402.4ºC at 760 mmHg. |
| Q: What is the CAS number of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: CAS number of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is 39595-35-2. |
| Q: What is the LogP of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: LogP of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is 2.13280. |
| Q: What is the InChIKey of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: InChIKey of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is CBCGHBBXNYFBMF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-(2-ethoxyphenyl)-4-oxobutanoic acid? |
| A: Molecular formula of 4-(2-ethoxyphenyl)-4-oxobutanoic acid is C12H14O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |