2-methyl-3,5-dinitrobenzoyl chloride structure
|
Common Name | 2-methyl-3,5-dinitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 39614-85-2 | Molecular Weight | 244.58900 | |
| Density | 1.569g/cm3 | Boiling Point | 358.3ºC at 760 mmHg | |
| Molecular Formula | C8H5ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 2-methyl-3,5-dinitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.569g/cm3 |
|---|---|
| Boiling Point | 358.3ºC at 760 mmHg |
| Molecular Formula | C8H5ClN2O5 |
| Molecular Weight | 244.58900 |
| Flash Point | 170.5ºC |
| Exact Mass | 243.98900 |
| PSA | 108.71000 |
| LogP | 3.23680 |
| Index of Refraction | 1.615 |
| InChIKey | AGYLEAJVAFGNEF-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~97%
2-methyl-3,5-di... CAS#:39614-85-2 |
| Literature: Spanggord, Ronald J.; Clizbe, Lane A. Journal of Labelled Compounds and Radiopharmaceuticals, 1998 , vol. 41, # 7 p. 615 - 621 |
|
~%
2-methyl-3,5-di... CAS#:39614-85-2 |
| Literature: McGookin; Swift; Tittensor Journal of the Society of Chemical Industry, London, 1940 , vol. 59, p. 92,94 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-methyl-3,5-dinitro-benzoyl chloride |
| 2-Methyl-3,5-dinitro-benzoylchlorid |
| 3,5-dinitro-2-methylbenzoyl chloride |
| EINECS 254-540-9 |
| 3.5-Dinitro-o-toluoylchlorid |