3-methyl-9H-fluorene-9-carboxylic acid structure
|
Common Name | 3-methyl-9H-fluorene-9-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 39627-23-1 | Molecular Weight | 224.25500 | |
| Density | 1.267g/cm3 | Boiling Point | 337.6ºC at 760 mmHg | |
| Molecular Formula | C15H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | 3-methyl-9H-fluorene-9-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760 mmHg |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.25500 |
| Flash Point | 172.2ºC |
| Exact Mass | 224.08400 |
| PSA | 37.30000 |
| LogP | 3.19190 |
| Index of Refraction | 1.652 |
| InChIKey | MKENFVCCHTWCRE-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)-c1ccccc1C2C(=O)O |
|
~%
3-methyl-9H-flu... CAS#:39627-23-1 |
| Literature: Bavin,P.M.G. Canadian Journal of Chemistry, 1960 , vol. 38, p. 911 - 916 |
|
~%
3-methyl-9H-flu... CAS#:39627-23-1 |
| Literature: Vorlaender; Pritzsche Chemische Berichte, 1913 , vol. 46, p. 1795 |
| 3-Methyl-fluoren-9-carbonsaeure |
| 3-methyl-fluorene-9-carboxylic acid |