n-(2,2-Diphenylethyl)thiourea
Modify Date: 2025-08-30 08:26:38
n-(2,2-Diphenylethyl)thiourea structure
|
Common Name | n-(2,2-Diphenylethyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 3963-63-1 | Molecular Weight | 256.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | n-(2,2-Diphenylethyl)thiourea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N2S |
|---|---|
| Molecular Weight | 256.4 |
| InChIKey | CNLYQTJEHVEZRH-UHFFFAOYSA-N |
| SMILES | NC(=S)NCC(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of n-(2,2-Diphenylethyl)thiourea? |
| A: Molecular formula of n-(2,2-Diphenylethyl)thiourea is C15H16N2S. |
| Q: What is the SMILES notation of n-(2,2-Diphenylethyl)thiourea? |
| A: SMILES notation of n-(2,2-Diphenylethyl)thiourea is NC(=S)NCC(c1ccccc1)c1ccccc1. |
| Q: What is the InChIKey of n-(2,2-Diphenylethyl)thiourea? |
| A: InChIKey of n-(2,2-Diphenylethyl)thiourea is CNLYQTJEHVEZRH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of n-(2,2-Diphenylethyl)thiourea? |
| A: Molecular weight of n-(2,2-Diphenylethyl)thiourea is 256.4. |
| Q: What is the Chinese name of 3963-63-1? |
| A: Chinese name of 3963-63-1 is 3963-63-1. |
| Q: What is the CAS number of n-(2,2-Diphenylethyl)thiourea? |
| A: CAS number of n-(2,2-Diphenylethyl)thiourea is 3963-63-1. |
| Q: What is the English name of n-(2,2-Diphenylethyl)thiourea? |
| A: The English name of n-(2,2-Diphenylethyl)thiourea is n-(2,2-Diphenylethyl)thiourea. |