5-oxo-1-phenyl-N-[2-(tert-butylcarbamoyl)phenyl]pyrrolidine-3-carboxam ide structure
|
Common Name | 5-oxo-1-phenyl-N-[2-(tert-butylcarbamoyl)phenyl]pyrrolidine-3-carboxam ide | ||
|---|---|---|---|---|
| CAS Number | 39630-07-4 | Molecular Weight | 379.45200 | |
| Density | 1.228g/cm3 | Boiling Point | 690ºC at 760 mmHg | |
| Molecular Formula | C22H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.1ºC | |
| Name | N-[2-(tert-butylcarbamoyl)phenyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 690ºC at 760 mmHg |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.45200 |
| Flash Point | 371.1ºC |
| Exact Mass | 379.19000 |
| PSA | 85.49000 |
| LogP | 4.49580 |
| Index of Refraction | 1.615 |
| InChIKey | WCWFPHDGSXZDRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)c1ccccc1NC(=O)C1CC(=O)N(c2ccccc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Pyrrolidinecarboxamide,N-(2-(((1,1-dimethylethyl)amino)carbonyl)phenyl)-5-oxo-1-phenyl |
| N-(2-(((1,1-Dimethylethyl)amino)carbonyl)phenyl)-5-oxo-1-phenyl-3-pyrrolidinecarboxamide |
| N-tert-butyl-2-(5-oxo-1-phenyl-pyrrolidine-3-carbonylamino)-benzamide |
| 5-OXO-1-PHENYL-N-[2-(TERT-BUTYLCARBAMOYL)PHENYL]PYRROLIDINE-3-CARBOXAM IDE |