2,3,3',5,5'-PCB structure
|
Common Name | 2,3,3',5,5'-PCB | ||
|---|---|---|---|---|
| CAS Number | 39635-32-0 | Molecular Weight | 326.433 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 392.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H5Cl5 | Melting Point | 95.86°C (estimate) | |
| MSDS | N/A | Flash Point | 193.6±23.9 °C | |
| Name | 2,3,3',5,5'-Pentachlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 392.3±37.0 °C at 760 mmHg |
| Melting Point | 95.86°C (estimate) |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.433 |
| Flash Point | 193.6±23.9 °C |
| Exact Mass | 323.883392 |
| LogP | 6.55 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | QMUDLTGWHILKHH-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(-c2cc(Cl)cc(Cl)c2Cl)c1 |
| Storage condition | 2-8°C |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,5-trichloro-3-(3,5-dichlorophenyl)benzene |
| 2,3,3',5,5'-PENTACHLOROBIPHENYL |
| 2,3,3',5,5'-PCB |
| 2,3,3',5,5'-Pentachloro-1,1'-biphenyl |