4,4'-Sulfonylbis(2,6-dibromophenol) structure
|
Common Name | 4,4'-Sulfonylbis(2,6-dibromophenol) | ||
|---|---|---|---|---|
| CAS Number | 39635-79-5 | Molecular Weight | 565.855 | |
| Density | 2.4±0.1 g/cm3 | Boiling Point | 539.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Br4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.0±30.1 °C | |
| Name | 4,4'-Sulphonylbis(2,6-Dibromophenol) |
|---|---|
| Synonym | More Synonyms |
| Density | 2.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 539.4±50.0 °C at 760 mmHg |
| Molecular Formula | C12H6Br4O4S |
| Molecular Weight | 565.855 |
| Flash Point | 280.0±30.1 °C |
| Exact Mass | 561.671997 |
| PSA | 82.98000 |
| LogP | 7.16 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | JHJUYGMZIWDHMO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1 |
| RIDADR | 3152 |
|---|---|
| Packaging Group | II |
| Hazard Class | 9 |
| HS Code | 2908999090 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
| 4,4'-Sulphonybis(2,6-dibromophenol) |
| Tetrabromobisphenol S |
| 2,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl)sulfonylphenol |
| EINECS 254-551-9 |
| 4,4'-Sulfonylbis(2,6-dibromophenol) |