2-(3,5-dichlorophenoxy)butanoic acid structure
|
Common Name | 2-(3,5-dichlorophenoxy)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 39644-27-4 | Molecular Weight | 249.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-dichlorophenoxy)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10Cl2O3 |
|---|---|
| Molecular Weight | 249.09100 |
| Exact Mass | 248.00100 |
| PSA | 46.53000 |
| LogP | 3.23540 |
| InChIKey | XBQZTXIEWGIKFR-UHFFFAOYSA-N |
| SMILES | CCC(Oc1cc(Cl)cc(Cl)c1)C(=O)O |
|
~%
2-(3,5-dichloro... CAS#:39644-27-4 |
| Literature: Stauffer Chemical Company Patent: US3953507 A1, 1976 ; |
|
~%
2-(3,5-dichloro... CAS#:39644-27-4 |
| Literature: Fawcett et al. Annals of Applied Biology, 1955 , vol. 43, p. 342,343, 344 Proceedings of the Royal Society of London, Series B: Biological Sciences, 1959 , vol. 150, p. 95,96, 100 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butanoic acid,2-(3,5-dichlorophenoxy) |
| 2-(3,5-dichloro-phenoxy)-butyric acid |
| 2-(3,5-dichlorphenoxy)buttersaeure |
| 5-DICHLOROPHENOXY)-BUTYRIC acid |