1-phenyl-4-(2-pyridin-2-ylethyl)piperazine
1-phenyl-4-(2-pyridin-2-ylethyl)piperazine structure
|
Common Name | 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 3965-85-3 | Molecular Weight | 267.36900 | |
| Density | 1.094g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C17H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
Summary: 1-Phenyl-4-(2-pyridin-2-ylethyl)piperazine, Chinese name: 1-苯基-4-(2-吡啶-2-基乙基)哌嗪, CAS number: 3965-85-3, molecular formula: C17H21N3, molecular weight: 267.36900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.094g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.36900 |
| Flash Point | 198.6ºC |
| Exact Mass | 267.17400 |
| PSA | 19.37000 |
| LogP | 2.44920 |
| Index of Refraction | 1.585 |
| InChIKey | TUIDRUSFPFFFRQ-UHFFFAOYSA-N |
| SMILES | c1ccc(N2CCN(CCc3ccccn3)CC2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-phenyl-4-(2-p... CAS#:3965-85-3 |
| Literature: Beller, Matthias; Trauthwein, Harald; Eichberger, Martin; Breindl, Claudia; Mueller, Thomas E. European Journal of Inorganic Chemistry, 1999 , # 7 p. 1121 - 1132 |
|
~%
1-phenyl-4-(2-p... CAS#:3965-85-3 |
| Literature: Beller, Matthias; Trauthwein, Harald; Eichberger, Martin; Breindl, Claudia; Mueller, Thomas E. European Journal of Inorganic Chemistry, 1999 , # 7 p. 1121 - 1132 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: LogP of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is 2.44920. |
| Q: What is the Chinese name of 3965-85-3? |
| A: Chinese name of 3965-85-3 is 3965-85-3. |
| Q: What is the molecular weight of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: Molecular weight of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is 267.36900. |
| Q: What is the SMILES notation of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: SMILES notation of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is c1ccc(N2CCN(CCc3ccccn3)CC2)cc1. |
| Q: What is the boiling point of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: Boiling point of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is 404.8ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: InChIKey of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is TUIDRUSFPFFFRQ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: The English name of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine. |
| Q: What is the molecular formula of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: Molecular formula of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is C17H21N3. |
| Q: What is the polar surface area (PSA) of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: Polar surface area (PSA) of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is 19.37000. |
| Q: What is the CAS number of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine? |
| A: CAS number of 1-phenyl-4-(2-pyridin-2-ylethyl)piperazine is 3965-85-3. |