2,4-Dichlorophenoxyacetic acid 2-butoxy-1-methylethyl ester
Modify Date: 2025-11-03 17:42:53
2,4-Dichlorophenoxyacetic acid 2-butoxy-1-methylethyl ester structure
|
Common Name | 2,4-Dichlorophenoxyacetic acid 2-butoxy-1-methylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3966-11-8 | Molecular Weight | 335.22300 | |
| Density | 1.198g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C15H20Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151ºC | |
| Name | 1-butoxypropan-2-yl 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C15H20Cl2O4 |
| Molecular Weight | 335.22300 |
| Flash Point | 151ºC |
| Exact Mass | 334.07400 |
| PSA | 44.76000 |
| LogP | 4.12060 |
| Index of Refraction | 1.507 |
| InChIKey | WMEYEJLFPRLQAP-UHFFFAOYSA-N |
| SMILES | CCCCOCC(C)OC(=O)COc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
2,4-Dichlorophe... CAS#:3966-11-8 |
| Literature: Dow Chem. Co. Patent: US2523189 , 1948 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-D 2-butoxyisopropyl ester |
| 2-Propanol,1-butoxy-,(2,4-dichlorophenoxy)acetate |
| 2-Butoxy-1-methylethyl (2,4-dichlorophenoxy)acetate |
| Acetic acid,(2,4-dichlorophenoxy)-,2-butoxy-1-methylethyl ester |
| 2,4-D,2-BUTOXYMETHYLETHYL ESTER |