N-[2-(methylcarbamothioyl)phenyl]benzamide structure
|
Common Name | N-[2-(methylcarbamothioyl)phenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 396716-38-4 | Molecular Weight | 270.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(methylcarbamothioyl)phenyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2OS |
|---|---|
| Molecular Weight | 270.34900 |
| Exact Mass | 270.08300 |
| PSA | 83.75000 |
| LogP | 3.62910 |
| InChIKey | IFRHFWHGEOKJFZ-UHFFFAOYSA-N |
| SMILES | CNC(=S)c1ccccc1NC(=O)c1ccccc1 |
|
~62%
N-[2-(methylcar... CAS#:396716-38-4 |
| Literature: Hanusek, Jiri; Rosa, Pavel; Drabina, Pavel; Sedlak, Milos Journal of Heterocyclic Chemistry, 2006 , vol. 43, # 5 p. 1281 - 1285 |
|
~%
N-[2-(methylcar... CAS#:396716-38-4 |
| Literature: Hanusek, Jiri; Rosa, Pavel; Drabina, Pavel; Sedlak, Milos Journal of Heterocyclic Chemistry, 2006 , vol. 43, # 5 p. 1281 - 1285 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzamide,N-[2-[(methylamino)thioxomethyl]phenyl] |
| 2-benzoylamino-N-methylthiobenzamide |