tert-Butyl 3,5-dioxopiperidine-1-carboxylate structure
|
Common Name | tert-Butyl 3,5-dioxopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 396731-40-1 | Molecular Weight | 213.230 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 346.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C10H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2±25.1 °C | |
| Name | tert-butyl 3,5-dioxopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.2±32.0 °C at 760 mmHg |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.230 |
| Flash Point | 163.2±25.1 °C |
| Exact Mass | 213.100113 |
| PSA | 63.68000 |
| LogP | -0.26 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | KWNDKZADLGFSKE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC(=O)C1 |
| HS Code | 2933399090 |
|---|
|
~52%
tert-Butyl 3,5-... CAS#:396731-40-1 |
| Literature: NOVO NORDISK A/S Patent: WO2006/3096 A1, 2006 ; Location in patent: Page/Page column 80 ; WO 2006/003096 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3,5-dioxo-, 1,1-dimethylethyl ester |
| 1,1-dimethylethyl 3,5-dioxo-1-piperidinecarboxylate |
| tert-Butyl 3,5-dioxopiperidine-1-carboxylate |
| 2-Methyl-2-propanyl 3,5-dioxo-1-piperidinecarboxylate |
| 1-[(1,1-dimethylethoxy)carbonyl]-3,5-dioxopiperidine |