9-dimethoxyphosphoryl-9H-thioxanthene structure
|
Common Name | 9-dimethoxyphosphoryl-9H-thioxanthene | ||
|---|---|---|---|---|
| CAS Number | 39730-71-7 | Molecular Weight | 306.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-dimethoxyphosphoryl-9H-thioxanthene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H15O3PS |
|---|---|
| Molecular Weight | 306.31700 |
| Exact Mass | 306.04800 |
| PSA | 70.64000 |
| LogP | 4.72650 |
| InChIKey | ZBOWABVWHWCKGH-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C1c2ccccc2Sc2ccccc21 |
|
~%
9-dimethoxyphos... CAS#:39730-71-7 |
| Literature: Griffiths, D. Vaughan; Griffiths, Penelope A.; Karim, Khalku; Whitehead, Belinda J. Journal of the Chemical Society - Perkin Transactions 1, 1996 , # 6 p. 555 - 561 |
|
~%
9-dimethoxyphos... CAS#:39730-71-7 |
| Literature: Griffiths, D. Vaughan; Griffiths, Penelope A.; Karim, Khalku; Whitehead, Belinda J. Journal of the Chemical Society - Perkin Transactions 1, 1996 , # 6 p. 555 - 561 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dimethyl 9H-thioxanthen-9-ylphosphonate |
| Phosphonic acid,9H-thioxanthen-9-yl-,dimethyl ester |
| thioxanthen-9-yl-phosphonic acid dimethyl ester |
| Dimethyl-9-thiaxanthanphosphonat |