L-Altruronsaure
Modify Date: 2025-10-10 13:47:44
L-Altruronsaure structure
|
Common Name | L-Altruronsaure | ||
|---|---|---|---|---|
| CAS Number | 39737-41-2 | Molecular Weight | 194.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | L-Altruronsaure |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H10O7 |
|---|---|
| Molecular Weight | 194.14 |
| InChIKey | IAJILQKETJEXLJ-NRXMZTRTSA-N |
| SMILES | O=CC(O)C(O)C(O)C(O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 39737-41-2? |
| A: Chinese name of 39737-41-2 is 39737-41-2. |
| Q: What is the InChIKey of L-Altruronsaure? |
| A: InChIKey of L-Altruronsaure is IAJILQKETJEXLJ-NRXMZTRTSA-N. |
| Q: What is the SMILES notation of L-Altruronsaure? |
| A: SMILES notation of L-Altruronsaure is O=CC(O)C(O)C(O)C(O)C(=O)O. |
| Q: What is the molecular formula of L-Altruronsaure? |
| A: Molecular formula of L-Altruronsaure is C6H10O7. |
| Q: What is the CAS number of L-Altruronsaure? |
| A: CAS number of L-Altruronsaure is 39737-41-2. |
| Q: What is the English name of L-Altruronsaure? |
| A: The English name of L-Altruronsaure is L-Altruronsaure. |
| Q: What is the molecular weight of L-Altruronsaure? |
| A: Molecular weight of L-Altruronsaure is 194.14. |