1-[2-(4-methoxyphenyl)ethyl]-4-piperidone structure
|
Common Name | 1-[2-(4-methoxyphenyl)ethyl]-4-piperidone | ||
|---|---|---|---|---|
| CAS Number | 39742-63-7 | Molecular Weight | 233.30600 | |
| Density | 1.078g/cm3 | Boiling Point | 371.6ºC at 760mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | 1-[2-(4-methoxyphenyl)ethyl]piperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 371.6ºC at 760mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 178.5ºC |
| Exact Mass | 233.14200 |
| PSA | 29.54000 |
| LogP | 1.84050 |
| Index of Refraction | 1.534 |
| InChIKey | BAPDJTACENRPEN-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN2CCC(=O)CC2)cc1 |
|
~%
1-[2-(4-methoxy... CAS#:39742-63-7 |
| Literature: Janssens; Torremans; Janssen; Stokbroekx; Luyckx Journal of Medicinal Chemistry, 1985 , vol. 28, # 12 p. 1925 - 1933 |
|
~%
1-[2-(4-methoxy... CAS#:39742-63-7 |
| Literature: Janssens; Torremans; Janssen; Stokbroekx; Luyckx Journal of Medicinal Chemistry, 1985 , vol. 28, # 12 p. 1925 - 1933 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| einecs 254-614-0 |