2-(3-oxo-1,3-diphenyl-propyl)cyclopentan-1-one
2-(3-oxo-1,3-diphenyl-propyl)cyclopentan-1-one structure
|
Common Name | 2-(3-oxo-1,3-diphenyl-propyl)cyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 39745-17-0 | Molecular Weight | 292.37200 | |
| Density | 1.138g/cm3 | Boiling Point | 465.2ºC at 760 mmHg | |
| Molecular Formula | C20H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
Summary: 2-(3-oxo-1,3-diphenyl-propyl)cyclopentan-1-one, Chinese name is 2-(3-氧代-1,3-二苯基丙基)环戊烷-1-酮, CAS number is 39745-17-0, molecular formula is C20H20O2, and molecular weight is 292.37200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 465.2ºC at 760 mmHg |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.37200 |
| Flash Point | 173ºC |
| Exact Mass | 292.14600 |
| PSA | 34.14000 |
| LogP | 4.41240 |
| Index of Refraction | 1.589 |
| InChIKey | IQTCJKVODXEBPC-UHFFFAOYSA-N |
| SMILES | O=C(CC(c1ccccc1)C1CCCC1=O)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2,4-diphenyl-6,7-dihydro-5H-cyclopenta[b]pyridine structure](https://image.chemsrc.com/caspic/424/78018-73-2.png)
CAS#:78018-73-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(2-Oxo-cyclopentyl)-1.3-diphenyl-propanon-(3) |
| 1,3-Diphenyl-1-(2-oxocyclopentyl)propan-3-one |
| 3-(2-oxo-cyclopentyl)-1,3-diphenyl-propan-1-one |
| 1,3-Diphenyl-3-(2'-oxocyclopentyl)-1-propanone |
| 3-(cyclopentan-2-one)-1,3-diphenylpropane-1-one |
| 3-(2-Oxo-cyclopentyl)-1,3-diphenyl-propan-1-on |
| 2-(3-oxo-1,3-diphenylpropyl)cyclopentanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: Related downstream products(CAS) of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one: 78018-73-2. |
| Q: What is the polar surface area (PSA) of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: Polar surface area (PSA) of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is 34.14000. |
| Q: What is the CAS number of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: CAS number of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is 39745-17-0. |
| Q: What is the molecular formula of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: Molecular formula of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is C20H20O2. |
| Q: What is the SMILES notation of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: SMILES notation of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is O=C(CC(c1ccccc1)C1CCCC1=O)c1ccccc1. |
| Q: What is the boiling point of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: Boiling point of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is 465.2ºC at 760 mmHg. |
| Q: What is the English name of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: The English name of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one. |
| Q: What English synonyms does 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one have? |
| A: English synonyms of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one: 1-(2-Oxo-cyclopentyl)-1.3-diphenyl-propanon-(3), 1,3-Diphenyl-1-(2-oxocyclopentyl)propan-3-one, 3-(2-oxo-cyclopentyl)-1,3-diphenyl-propan-1-one, 1,3-Diphenyl-3-(2'-oxocyclopentyl)-1-propanone, 3-(cyclopentan-2-one)-1,3-diphenylpropane-1-one, 3-(2-Oxo-cyclopentyl)-1,3-diphenyl-propan-1-on, 2-(3-oxo-1,3-diphenylpropyl)cyclopentanone. |
| Q: What is the LogP of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one? |
| A: LogP of 2-(3-oxo-1,3-diphenylpropyl)cyclopentan-1-one is 4.41240. |
| Q: What is the Chinese name of 39745-17-0? |
| A: Chinese name of 39745-17-0 is 39745-17-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |