3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride
Modify Date: 2025-08-27 07:58:01
3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride structure
|
Common Name | 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 39751-85-4 | Molecular Weight | 322.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5BrClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H5BrClN3O2S |
|---|---|
| Molecular Weight | 322.57 |
| InChIKey | YHEFZVDKSQINMQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1nc(-c2ccccc2Br)n[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride? |
| A: The English name of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride. |
| Q: What is the Chinese name of 39751-85-4? |
| A: Chinese name of 39751-85-4 is 39751-85-4. |
| Q: What is the molecular formula of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride? |
| A: Molecular formula of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is C8H5BrClN3O2S. |
| Q: What is the molecular weight of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride? |
| A: Molecular weight of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is 322.57. |
| Q: What is the InChIKey of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride? |
| A: InChIKey of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is YHEFZVDKSQINMQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride? |
| A: SMILES notation of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is O=S(=O)(Cl)c1nc(-c2ccccc2Br)n[nH]1. |
| Q: What is the CAS number of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride? |
| A: CAS number of 3-(2-Bromophenyl)-1H-1,2,4-triazole-5-sulfonyl chloride is 39751-85-4. |