6-(4-Bromophenyl)-1,3-diazinane-2,4-dione
Modify Date: 2026-08-21 07:46:34
6-(4-Bromophenyl)-1,3-diazinane-2,4-dione structure
|
Common Name | 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 39773-50-7 | Molecular Weight | 269.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9BrN2O2 |
|---|---|
| Molecular Weight | 269.09 |
| InChIKey | RKCJUOTXNIQTOX-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(Br)cc2)NC(=O)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione? |
| A: Molecular weight of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione is 269.09. |
| Q: What is the English name of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione? |
| A: The English name of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione is 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione. |
| Q: What is the CAS number of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione? |
| A: CAS number of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione is 39773-50-7. |
| Q: What is the SMILES notation of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione? |
| A: SMILES notation of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione is O=C1CC(c2ccc(Br)cc2)NC(=O)N1. |
| Q: What is the Chinese name of 39773-50-7? |
| A: Chinese name of 39773-50-7 is 39773-50-7. |
| Q: What is the InChIKey of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione? |
| A: InChIKey of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione is RKCJUOTXNIQTOX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione? |
| A: Molecular formula of 6-(4-Bromophenyl)-1,3-diazinane-2,4-dione is C10H9BrN2O2. |