3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate
Modify Date: 2025-09-24 08:47:53
![3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/111/39775-33-2.png)
3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate structure
|
Common Name | 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 39775-33-2 | Molecular Weight | 328.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20N2O4 |
|---|---|
| Molecular Weight | 328.4 |
| InChIKey | OHQUXYIJZYICNI-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)c1cccnc1-c1ncccc1C(=O)OCCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate? |
| A: InChIKey of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate is OHQUXYIJZYICNI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate? |
| A: Molecular formula of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate is C18H20N2O4. |
| Q: What is the CAS number of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate? |
| A: CAS number of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate is 39775-33-2. |
| Q: What is the SMILES notation of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate? |
| A: SMILES notation of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate is CCCOC(=O)c1cccnc1-c1ncccc1C(=O)OCCC. |
| Q: What is the Chinese name of 39775-33-2? |
| A: Chinese name of 39775-33-2 is 39775-33-2. |
| Q: What is the molecular weight of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate? |
| A: Molecular weight of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate is 328.4. |
| Q: What is the English name of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate? |
| A: The English name of 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate is 3,3a(2)-Dipropyl [2,2a(2)-bipyridine]-3,3a(2)-dicarboxylate. |