1-(3,5-dimethoxyphenyl)pyrrole
1-(3,5-dimethoxyphenyl)pyrrole structure
|
Common Name | 1-(3,5-dimethoxyphenyl)pyrrole | ||
|---|---|---|---|---|
| CAS Number | 39779-23-2 | Molecular Weight | 203.23700 | |
| Density | 1.06g/cm3 | Boiling Point | 340ºC at 760 mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3,5-dimethoxyphenyl)pyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 340ºC at 760 mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 159.4ºC |
| Exact Mass | 203.09500 |
| PSA | 23.39000 |
| LogP | 2.49450 |
| Index of Refraction | 1.531 |
| InChIKey | LDOKAWAMZKTGRP-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(-n2cccc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Detail
Learn More
|
| Literature: Maag, Hans; Locher, Rita; Daly, John J.; Kompis, Ivan Helvetica Chimica Acta, 1986 , vol. 69, p. 887 - 897 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: Polar surface area (PSA) of 1-(3,5-dimethoxyphenyl)pyrrole is 23.39000. |
| Q: What is the LogP of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: LogP of 1-(3,5-dimethoxyphenyl)pyrrole is 2.49450. |
| Q: What is the SMILES notation of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: SMILES notation of 1-(3,5-dimethoxyphenyl)pyrrole is COc1cc(OC)cc(-n2cccc2)c1. |
| Q: What is the CAS number of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: CAS number of 1-(3,5-dimethoxyphenyl)pyrrole is 39779-23-2. |
| Q: What are the upstream materials of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: Related upstream materials(CAS) of 1-(3,5-dimethoxyphenyl)pyrrole: 696-59-3;542-05-2;10272-07-8. |
| Q: What is the molecular formula of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: Molecular formula of 1-(3,5-dimethoxyphenyl)pyrrole is C12H13NO2. |
| Q: What is the boiling point of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: Boiling point of 1-(3,5-dimethoxyphenyl)pyrrole is 340ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: InChIKey of 1-(3,5-dimethoxyphenyl)pyrrole is LDOKAWAMZKTGRP-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(3,5-dimethoxyphenyl)pyrrole? |
| A: The English name of 1-(3,5-dimethoxyphenyl)pyrrole is 1-(3,5-dimethoxyphenyl)pyrrole. |
| Q: What is the Chinese name of 39779-23-2? |
| A: Chinese name of 39779-23-2 is 39779-23-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |